C30H24Cl2N4O3S — CID 22188939
N-[(Z)-3-[4-[1-(2,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide (PubChem CID 22188939) has the molecular formula C30H24Cl2N4O3S and a molecular weight of 591.52 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(2,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(2,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22188939 |
| Molecular Formula | C30H24Cl2N4O3S |
| Molecular Weight | 591.52 g/mol |
| Exact Mass | 590.09 |
| IUPAC Name | N-[(Z)-3-[4-[1-(2,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2cccnc2)NC(=O)c2ccccc2)cc1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C30H24Cl2N4O3S/c1-19(28(37)35-26-17-22(31)9-14-25(26)32)40-24-12-10-23(11-13-24)34-30(39)27(16-20-6-5-15-33-18-20)36-29(38)21-7-3-2-4-8-21/h2-19H,1H3,(H,34,39)(H,35,37)(H,36,38)/b27-16- |
| InChIKey | YPOYNYMIMGEFBO-YUMHPJSZSA-N |
| XLogP | 6.92 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.52 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|