C30H27N3O4S2 — CID 22188755
N-[(Z)-3-[4-[1-(3-methoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide (PubChem CID 22188755) has the molecular formula C30H27N3O4S2 and a molecular weight of 557.70 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(3-methoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(3-methoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22188755 |
| Molecular Formula | C30H27N3O4S2 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | N-[(Z)-3-[4-[1-(3-methoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(NC(=O)C(C)Sc2ccc(NC(=O)/C(=C/c3ccsc3)NC(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C30H27N3O4S2/c1-20(28(34)32-24-9-6-10-25(18-24)37-2)39-26-13-11-23(12-14-26)31-30(36)27(17-21-15-16-38-19-21)33-29(35)22-7-4-3-5-8-22/h3-20H,1-2H3,(H,31,36)(H,32,34)(H,33,35)/b27-17- |
| InChIKey | SPUBAAVUGPHUKI-PKAZHMFMSA-N |
| XLogP | 6.29 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|