C44H35N5O5S — CID 19713722
N-[(Z)-3-[4-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19713722) has the molecular formula C44H35N5O5S and a molecular weight of 745.86 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19713722 |
| Molecular Formula | C44H35N5O5S |
| Molecular Weight | 745.86 g/mol |
| Exact Mass | 745.24 |
| IUPAC Name | N-[(Z)-3-[4-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)C(Sc3ccc(NC(=O)/C(=C/c4ccccc4[N+](=O)[O-])NC(=O)c4ccccc4)cc3)c3ccccc3)ccc21 |
| InChI | InChI=1S/C44H35N5O5S/c1-2-48-39-20-12-10-18-35(39)36-28-33(23-26-40(36)48)46-44(52)41(29-13-5-3-6-14-29)55-34-24-21-32(22-25-34)45-43(51)37(47-42(50)30-15-7-4-8-16-30)27-31-17-9-11-19-38(31)49(53)54/h3-28,41H,2H2,1H3,(H,45,51)(H,46,52)(H,47,50)/b37-27- |
| InChIKey | MOAPCMFLMNHVJB-QOSQFQCFSA-N |
| XLogP | 9.60 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.86 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|