C38H32N4O5S — CID 21384707
N-[(Z)-3-[4-[2-(3,4-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21384707) has the molecular formula C38H32N4O5S and a molecular weight of 656.76 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(3,4-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(3,4-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21384707 |
| Molecular Formula | C38H32N4O5S |
| Molecular Weight | 656.76 g/mol |
| Exact Mass | 656.21 |
| IUPAC Name | N-[(Z)-3-[4-[2-(3,4-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(NC(=O)C(Sc2ccc(NC(=O)/C(=C/c3ccccc3[N+](=O)[O-])NC(=O)c3ccccc3)cc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C38H32N4O5S/c1-25-17-18-31(23-26(25)2)40-38(45)35(27-11-5-3-6-12-27)48-32-21-19-30(20-22-32)39-37(44)33(41-36(43)28-13-7-4-8-14-28)24-29-15-9-10-16-34(29)42(46)47/h3-24,35H,1-2H3,(H,39,44)(H,40,45)(H,41,43)/b33-24- |
| InChIKey | XUNXXXJYSKHRSI-GIBOGKFOSA-N |
| XLogP | 8.09 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.76 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|