C34H32N4O5S — CID 19306336
N-[(E)-3-[3-[1-(3,4-dimethylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19306336) has the molecular formula C34H32N4O5S and a molecular weight of 608.72 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(3,4-dimethylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(3,4-dimethylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19306336 |
| Molecular Formula | C34H32N4O5S |
| Molecular Weight | 608.72 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | N-[(E)-3-[3-[1-(3,4-dimethylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccccc2[N+](=O)[O-])NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C34H32N4O5S/c1-4-31(34(41)36-27-18-17-22(2)23(3)19-27)44-28-15-10-14-26(21-28)35-33(40)29(37-32(39)24-11-6-5-7-12-24)20-25-13-8-9-16-30(25)38(42)43/h5-21,31H,4H2,1-3H3,(H,35,40)(H,36,41)(H,37,39)/b29-20+ |
| InChIKey | JGIZZRBQTXOXJF-ZTKZIYFRSA-N |
| XLogP | 7.13 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.72 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|