C43H31N5O6S — CID 21384754
N-[(Z)-3-[4-[2-[4-(1,3-benzoxazol-2-yl)anilino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21384754) has the molecular formula C43H31N5O6S and a molecular weight of 745.82 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-[4-(1,3-benzoxazol-2-yl)anilino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-[4-(1,3-benzoxazol-2-yl)anilino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21384754 |
| Molecular Formula | C43H31N5O6S |
| Molecular Weight | 745.82 g/mol |
| Exact Mass | 745.20 |
| IUPAC Name | N-[(Z)-3-[4-[2-[4-(1,3-benzoxazol-2-yl)anilino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2ccc(-c3nc4ccccc4o3)cc2)c2ccccc2)cc1)/C(=C/c1ccccc1[N+](=O)[O-])NC(=O)c1ccccc1 |
| InChI | InChI=1S/C43H31N5O6S/c49-40(29-13-5-2-6-14-29)46-36(27-31-15-7-9-17-37(31)48(52)53)41(50)44-33-23-25-34(26-24-33)55-39(28-11-3-1-4-12-28)42(51)45-32-21-19-30(20-22-32)43-47-35-16-8-10-18-38(35)54-43/h1-27,39H,(H,44,50)(H,45,51)(H,46,49)/b36-27- |
| InChIKey | ATNQFVHUDHZJTA-RLANJUCJSA-N |
| XLogP | 9.28 |
| TPSA | 156.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.82 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|