C38H29N5O6S — CID 21384614
N-[(Z)-3-[4-[1-[4-(1,3-benzoxazol-2-yl)anilino]-1-oxopropan-2-yl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21384614) has the molecular formula C38H29N5O6S and a molecular weight of 683.75 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-[4-(1,3-benzoxazol-2-yl)anilino]-1-oxopropan-2-yl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-[4-(1,3-benzoxazol-2-yl)anilino]-1-oxopropan-2-yl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21384614 |
| Molecular Formula | C38H29N5O6S |
| Molecular Weight | 683.75 g/mol |
| Exact Mass | 683.18 |
| IUPAC Name | N-[(Z)-3-[4-[1-[4-(1,3-benzoxazol-2-yl)anilino]-1-oxopropan-2-yl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2ccccc2[N+](=O)[O-])NC(=O)c2ccccc2)cc1)C(=O)Nc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C38H29N5O6S/c1-24(35(44)39-28-17-15-26(16-18-28)38-42-31-12-6-8-14-34(31)49-38)50-30-21-19-29(20-22-30)40-37(46)32(41-36(45)25-9-3-2-4-10-25)23-27-11-5-7-13-33(27)43(47)48/h2-24H,1H3,(H,39,44)(H,40,46)(H,41,45)/b32-23- |
| InChIKey | YQYIZIXFRMFTTP-SJIPCVTESA-N |
| XLogP | 7.93 |
| TPSA | 156.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.75 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|