C34H29ClN4O3S — CID 99130048
N-[(Z)-3-[4-[(2S)-1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 99130048) has the molecular formula C34H29ClN4O3S and a molecular weight of 609.15 g/mol. Its IUPAC name is N-[(Z)-3-[4-[(2S)-1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[(2S)-1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 99130048 |
| Molecular Formula | C34H29ClN4O3S |
| Molecular Weight | 609.15 g/mol |
| Exact Mass | 608.16 |
| IUPAC Name | N-[(Z)-3-[4-[(2S)-1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)[C@H](C)Sc1ccc(NC(=O)/C(=C/c2c[nH]c3ccccc23)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H29ClN4O3S/c1-21-12-13-25(35)19-30(21)38-32(40)22(2)43-27-16-14-26(15-17-27)37-34(42)31(39-33(41)23-8-4-3-5-9-23)18-24-20-36-29-11-7-6-10-28(24)29/h3-20,22,36H,1-2H3,(H,37,42)(H,38,40)(H,39,41)/b31-18-/t22-/m0/s1 |
| InChIKey | XAKKANLSOPFCCE-MUKWFXSPSA-N |
| XLogP | 7.66 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.15 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|