C43H35N3O4S — CID 19313351
N-[(Z)-1-(2-methylphenyl)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19313351) has the molecular formula C43H35N3O4S and a molecular weight of 689.84 g/mol. Its IUPAC name is N-[(Z)-1-(2-methylphenyl)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-methylphenyl)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19313351 |
| Molecular Formula | C43H35N3O4S |
| Molecular Weight | 689.84 g/mol |
| Exact Mass | 689.23 |
| IUPAC Name | N-[(Z)-1-(2-methylphenyl)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | Cc1ccccc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1cccc(SC(C(=O)Nc2ccc(Oc3ccccc3)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C43H35N3O4S/c1-30-14-11-12-19-33(30)28-39(46-41(47)32-17-7-3-8-18-32)42(48)45-35-20-13-23-38(29-35)51-40(31-15-5-2-6-16-31)43(49)44-34-24-26-37(27-25-34)50-36-21-9-4-10-22-36/h2-29,40H,1H3,(H,44,49)(H,45,48)(H,46,47)/b39-28- |
| InChIKey | QSVGDRHXGIQYHK-WGSLGHPRSA-N |
| XLogP | 9.67 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.84 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|