C42H31Cl2N3O4S — CID 19307015
N-[(E)-1-(2,4-dichlorophenyl)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19307015) has the molecular formula C42H31Cl2N3O4S and a molecular weight of 744.70 g/mol. Its IUPAC name is N-[(E)-1-(2,4-dichlorophenyl)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,4-dichlorophenyl)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19307015 |
| Molecular Formula | C42H31Cl2N3O4S |
| Molecular Weight | 744.70 g/mol |
| Exact Mass | 743.14 |
| IUPAC Name | N-[(E)-1-(2,4-dichlorophenyl)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2ccc(Oc3ccccc3)cc2)c2ccccc2)c1)/C(=C\c1ccc(Cl)cc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C42H31Cl2N3O4S/c43-31-20-19-30(37(44)26-31)25-38(47-40(48)29-13-6-2-7-14-29)41(49)46-33-15-10-18-36(27-33)52-39(28-11-4-1-5-12-28)42(50)45-32-21-23-35(24-22-32)51-34-16-8-3-9-17-34/h1-27,39H,(H,45,50)(H,46,49)(H,47,48)/b38-25+ |
| InChIKey | UPYKBYHOJGIZKU-XPGZBYHPSA-N |
| XLogP | 10.67 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.70 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|