C38H32Cl2N4O3S — CID 19308708
N-[(E)-3-[3-[2-(3,5-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19308708) has the molecular formula C38H32Cl2N4O3S and a molecular weight of 695.67 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(3,5-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(3,5-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19308708 |
| Molecular Formula | C38H32Cl2N4O3S |
| Molecular Weight | 695.67 g/mol |
| Exact Mass | 694.16 |
| IUPAC Name | N-[(E)-3-[3-[2-(3,5-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CN(C)c1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C(=O)Nc3cc(Cl)cc(Cl)c3)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C38H32Cl2N4O3S/c1-44(2)32-18-16-25(17-19-32)20-34(43-36(45)27-12-7-4-8-13-27)37(46)41-30-14-9-15-33(24-30)48-35(26-10-5-3-6-11-26)38(47)42-31-22-28(39)21-29(40)23-31/h3-24,35H,1-2H3,(H,41,46)(H,42,47)(H,43,45)/b34-20+ |
| InChIKey | YBKPXSMKJKATFZ-QXUDOOCXSA-N |
| XLogP | 8.94 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.67 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|