C35H31ClN4O3S — CID 19315830
N-[(Z)-3-[3-[1-(3-chloro-4-methylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19315830) has the molecular formula C35H31ClN4O3S and a molecular weight of 623.18 g/mol. Its IUPAC name is N-[(Z)-3-[3-[1-(3-chloro-4-methylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[1-(3-chloro-4-methylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19315830 |
| Molecular Formula | C35H31ClN4O3S |
| Molecular Weight | 623.18 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | N-[(Z)-3-[3-[1-(3-chloro-4-methylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2c[nH]c3ccccc23)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C35H31ClN4O3S/c1-3-32(35(43)39-26-17-16-22(2)29(36)20-26)44-27-13-9-12-25(19-27)38-34(42)31(40-33(41)23-10-5-4-6-11-23)18-24-21-37-30-15-8-7-14-28(24)30/h4-21,32,37H,3H2,1-2H3,(H,38,42)(H,39,43)(H,40,41)/b31-18- |
| InChIKey | ULRWAYLJEUTWGG-MNBJERMJSA-N |
| XLogP | 8.05 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.18 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|