C37H29Cl2N3O4S — CID 19309568
N-[(Z)-3-[3-[2-(2,3-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(3-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19309568) has the molecular formula C37H29Cl2N3O4S and a molecular weight of 682.63 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(2,3-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(3-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(2,3-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(3-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19309568 |
| Molecular Formula | C37H29Cl2N3O4S |
| Molecular Weight | 682.63 g/mol |
| Exact Mass | 681.13 |
| IUPAC Name | N-[(Z)-3-[3-[2-(2,3-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(3-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C(=O)Nc3cccc(Cl)c3Cl)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C37H29Cl2N3O4S/c1-46-28-17-8-11-24(21-28)22-32(42-35(43)26-14-6-3-7-15-26)36(44)40-27-16-9-18-29(23-27)47-34(25-12-4-2-5-13-25)37(45)41-31-20-10-19-30(38)33(31)39/h2-23,34H,1H3,(H,40,44)(H,41,45)(H,42,43)/b32-22- |
| InChIKey | PYTNBVRNGAGCIJ-JDCMOKTRSA-N |
| XLogP | 8.88 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.63 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|