C13H13Cl4NO3 — CID 4667244
1,3-dichloropropan-2-yl 4-(2,4-dichloroanilino)-4-oxobutanoate (PubChem CID 4667244) has the molecular formula C13H13Cl4NO3 and a molecular weight of 373.06 g/mol. Its IUPAC name is 1,3-dichloropropan-2-yl 4-(2,4-dichloroanilino)-4-oxobutanoate.
| Compound Name | 1,3-dichloropropan-2-yl 4-(2,4-dichloroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 4667244 |
| Molecular Formula | C13H13Cl4NO3 |
| Molecular Weight | 373.06 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | 1,3-dichloropropan-2-yl 4-(2,4-dichloroanilino)-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OC(CCl)CCl)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl4NO3/c14-6-9(7-15)21-13(20)4-3-12(19)18-11-2-1-8(16)5-10(11)17/h1-2,5,9H,3-4,6-7H2,(H,18,19) |
| InChIKey | NYSQGERPCZEIOZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.06 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|