C16H19FN2O5 — CID 120544465
1-[[(5-fluoro-3-methyl-2-nitrobenzoyl)amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 120544465) has the molecular formula C16H19FN2O5 and a molecular weight of 338.34 g/mol. Its IUPAC name is 1-[[(5-fluoro-3-methyl-2-nitrobenzoyl)amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[(5-fluoro-3-methyl-2-nitrobenzoyl)amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120544465 |
| Molecular Formula | C16H19FN2O5 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 1-[[(5-fluoro-3-methyl-2-nitrobenzoyl)amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1cc(F)cc(C(=O)NCC2(C(=O)O)CCCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19FN2O5/c1-10-7-11(17)8-12(13(10)19(23)24)14(20)18-9-16(15(21)22)5-3-2-4-6-16/h7-8H,2-6,9H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | QRZQUHVWIIBBIV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|