C13H16Cl2N2O2 — CID 82833008
4-amino-3,5-dichloro-N-[1-(hydroxymethyl)cyclopentyl]benzamide (PubChem CID 82833008) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-[1-(hydroxymethyl)cyclopentyl]benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-[1-(hydroxymethyl)cyclopentyl]benzamide |
|---|---|
| PubChem CID | 82833008 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4-amino-3,5-dichloro-N-[1-(hydroxymethyl)cyclopentyl]benzamide |
| SMILES | Nc1c(Cl)cc(C(=O)NC2(CO)CCCC2)cc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O2/c14-9-5-8(6-10(15)11(9)16)12(19)17-13(7-18)3-1-2-4-13/h5-6,18H,1-4,7,16H2,(H,17,19) |
| InChIKey | MLIGZDLNXMZNOR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|