C24H26BrClN2O3 — CID 166332734
N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-N'-[3-(4-chlorophenyl)cyclobutyl]oxamide (PubChem CID 166332734) has the molecular formula C24H26BrClN2O3 and a molecular weight of 505.84 g/mol. Its IUPAC name is N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-N'-[3-(4-chlorophenyl)cyclobutyl]oxamide.
| Compound Name | N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-N'-[3-(4-chlorophenyl)cyclobutyl]oxamide |
|---|---|
| PubChem CID | 166332734 |
| Molecular Formula | C24H26BrClN2O3 |
| Molecular Weight | 505.84 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-N'-[3-(4-chlorophenyl)cyclobutyl]oxamide |
| SMILES | O=C(NCC1(c2cccc(Br)c2)CCOCC1)C(=O)NC1CC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C24H26BrClN2O3/c25-19-3-1-2-18(14-19)24(8-10-31-11-9-24)15-27-22(29)23(30)28-21-12-17(13-21)16-4-6-20(26)7-5-16/h1-7,14,17,21H,8-13,15H2,(H,27,29)(H,28,30) |
| InChIKey | OMXYFYFFGDRZPD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.84 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|