C17H21ClN2O3S — CID 166211691
N'-[3-(4-chlorophenyl)cyclobutyl]-N-[(1-methylsulfinylcyclopropyl)methyl]oxamide (PubChem CID 166211691) has the molecular formula C17H21ClN2O3S and a molecular weight of 368.89 g/mol. Its IUPAC name is N'-[3-(4-chlorophenyl)cyclobutyl]-N-[(1-methylsulfinylcyclopropyl)methyl]oxamide.
| Compound Name | N'-[3-(4-chlorophenyl)cyclobutyl]-N-[(1-methylsulfinylcyclopropyl)methyl]oxamide |
|---|---|
| PubChem CID | 166211691 |
| Molecular Formula | C17H21ClN2O3S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N'-[3-(4-chlorophenyl)cyclobutyl]-N-[(1-methylsulfinylcyclopropyl)methyl]oxamide |
| SMILES | CS(=O)C1(CNC(=O)C(=O)NC2CC(c3ccc(Cl)cc3)C2)CC1 |
| InChI | InChI=1S/C17H21ClN2O3S/c1-24(23)17(6-7-17)10-19-15(21)16(22)20-14-8-12(9-14)11-2-4-13(18)5-3-11/h2-5,12,14H,6-10H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | QVJCGBNDMFYIOL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|