C18H26ClNO — CID 103965853
[1-[[[3-(4-chlorophenyl)cyclobutyl]amino]methyl]cyclohexyl]methanol (PubChem CID 103965853) has the molecular formula C18H26ClNO and a molecular weight of 307.86 g/mol. Its IUPAC name is [1-[[[3-(4-chlorophenyl)cyclobutyl]amino]methyl]cyclohexyl]methanol.
| Compound Name | [1-[[[3-(4-chlorophenyl)cyclobutyl]amino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 103965853 |
| Molecular Formula | C18H26ClNO |
| Molecular Weight | 307.86 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | [1-[[[3-(4-chlorophenyl)cyclobutyl]amino]methyl]cyclohexyl]methanol |
| SMILES | OCC1(CNC2CC(c3ccc(Cl)cc3)C2)CCCCC1 |
| InChI | InChI=1S/C18H26ClNO/c19-16-6-4-14(5-7-16)15-10-17(11-15)20-12-18(13-21)8-2-1-3-9-18/h4-7,15,17,20-21H,1-3,8-13H2 |
| InChIKey | JJYJBQXVWQQABI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.86 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |