C18H27NO — CID 103965842
[1-[[(4-cyclopropylphenyl)methylamino]methyl]cyclohexyl]methanol (PubChem CID 103965842) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is [1-[[(4-cyclopropylphenyl)methylamino]methyl]cyclohexyl]methanol.
| Compound Name | [1-[[(4-cyclopropylphenyl)methylamino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 103965842 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | [1-[[(4-cyclopropylphenyl)methylamino]methyl]cyclohexyl]methanol |
| SMILES | OCC1(CNCc2ccc(C3CC3)cc2)CCCCC1 |
| InChI | InChI=1S/C18H27NO/c20-14-18(10-2-1-3-11-18)13-19-12-15-4-6-16(7-5-15)17-8-9-17/h4-7,17,19-20H,1-3,8-14H2 |
| InChIKey | OXVBZYHEUFCFKG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |