C18H27ClN2O2 — CID 119749920
2-amino-N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-methylpentanamide (PubChem CID 119749920) has the molecular formula C18H27ClN2O2 and a molecular weight of 338.88 g/mol. Its IUPAC name is 2-amino-N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-methylpentanamide.
| Compound Name | 2-amino-N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 119749920 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 2-amino-N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-methylpentanamide |
| SMILES | CCC(C)C(N)C(=O)NCC1(c2cccc(Cl)c2)CCOCC1 |
| InChI | InChI=1S/C18H27ClN2O2/c1-3-13(2)16(20)17(22)21-12-18(7-9-23-10-8-18)14-5-4-6-15(19)11-14/h4-6,11,13,16H,3,7-10,12,20H2,1-2H3,(H,21,22) |
| InChIKey | FEHYTJSEJWZYAU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |