C24H30ClNO4 — CID 52737970
N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-4-(2-ethoxyphenoxy)butanamide (PubChem CID 52737970) has the molecular formula C24H30ClNO4 and a molecular weight of 431.96 g/mol. Its IUPAC name is N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-4-(2-ethoxyphenoxy)butanamide.
| Compound Name | N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-4-(2-ethoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 52737970 |
| Molecular Formula | C24H30ClNO4 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-4-(2-ethoxyphenoxy)butanamide |
| SMILES | CCOc1ccccc1OCCCC(=O)NCC1(c2cccc(Cl)c2)CCOCC1 |
| InChI | InChI=1S/C24H30ClNO4/c1-2-29-21-9-3-4-10-22(21)30-14-6-11-23(27)26-18-24(12-15-28-16-13-24)19-7-5-8-20(25)17-19/h3-5,7-10,17H,2,6,11-16,18H2,1H3,(H,26,27) |
| InChIKey | VGBRAVNJDVRYAM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|