C21H23ClN2O4 — CID 27452218
N'-(2-chlorophenyl)-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]oxamide (PubChem CID 27452218) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is N'-(2-chlorophenyl)-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]oxamide.
| Compound Name | N'-(2-chlorophenyl)-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]oxamide |
|---|---|
| PubChem CID | 27452218 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N'-(2-chlorophenyl)-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]oxamide |
| SMILES | COc1ccc(C2(CNC(=O)C(=O)Nc3ccccc3Cl)CCOCC2)cc1 |
| InChI | InChI=1S/C21H23ClN2O4/c1-27-16-8-6-15(7-9-16)21(10-12-28-13-11-21)14-23-19(25)20(26)24-18-5-3-2-4-17(18)22/h2-9H,10-14H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | KPUFXLOVOHNSTR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|