C16H20F3NO2S — CID 90604934
4,4,4-trifluoro-N-[(4-phenylsulfanyloxan-4-yl)methyl]butanamide (PubChem CID 90604934) has the molecular formula C16H20F3NO2S and a molecular weight of 347.40 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[(4-phenylsulfanyloxan-4-yl)methyl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[(4-phenylsulfanyloxan-4-yl)methyl]butanamide |
|---|---|
| PubChem CID | 90604934 |
| Molecular Formula | C16H20F3NO2S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 4,4,4-trifluoro-N-[(4-phenylsulfanyloxan-4-yl)methyl]butanamide |
| SMILES | O=C(CCC(F)(F)F)NCC1(Sc2ccccc2)CCOCC1 |
| InChI | InChI=1S/C16H20F3NO2S/c17-16(18,19)7-6-14(21)20-12-15(8-10-22-11-9-15)23-13-4-2-1-3-5-13/h1-5H,6-12H2,(H,20,21) |
| InChIKey | HYKLHJURAKJXDU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |