C25H31NO4S — CID 90604708
4-(2-methoxyphenyl)-N-[(4-phenylsulfanyloxan-4-yl)methyl]oxane-4-carboxamide (PubChem CID 90604708) has the molecular formula C25H31NO4S and a molecular weight of 441.59 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-N-[(4-phenylsulfanyloxan-4-yl)methyl]oxane-4-carboxamide.
| Compound Name | 4-(2-methoxyphenyl)-N-[(4-phenylsulfanyloxan-4-yl)methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 90604708 |
| Molecular Formula | C25H31NO4S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 4-(2-methoxyphenyl)-N-[(4-phenylsulfanyloxan-4-yl)methyl]oxane-4-carboxamide |
| SMILES | COc1ccccc1C1(C(=O)NCC2(Sc3ccccc3)CCOCC2)CCOCC1 |
| InChI | InChI=1S/C25H31NO4S/c1-28-22-10-6-5-9-21(22)25(13-17-30-18-14-25)23(27)26-19-24(11-15-29-16-12-24)31-20-7-3-2-4-8-20/h2-10H,11-19H2,1H3,(H,26,27) |
| InChIKey | JXYLROCWMPFIHD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |