C22H26ClNO4 — CID 90623808
N-[2-(2-chlorophenyl)-2-methoxyethyl]-4-(2-methoxyphenyl)oxane-4-carboxamide (PubChem CID 90623808) has the molecular formula C22H26ClNO4 and a molecular weight of 403.91 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-methoxyethyl]-4-(2-methoxyphenyl)oxane-4-carboxamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-methoxyethyl]-4-(2-methoxyphenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 90623808 |
| Molecular Formula | C22H26ClNO4 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-methoxyethyl]-4-(2-methoxyphenyl)oxane-4-carboxamide |
| SMILES | COc1ccccc1C1(C(=O)NCC(OC)c2ccccc2Cl)CCOCC1 |
| InChI | InChI=1S/C22H26ClNO4/c1-26-19-10-6-4-8-17(19)22(11-13-28-14-12-22)21(25)24-15-20(27-2)16-7-3-5-9-18(16)23/h3-10,20H,11-15H2,1-2H3,(H,24,25) |
| InChIKey | MHZAEYIEYDGSLS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |