C21H25N4O3S+ — CID 9266837
N-cyclopropyl-2-[[2-[4-(thiophene-2-carbonyl)piperazin-1-ium-1-yl]acetyl]amino]benzamide (PubChem CID 9266837) has the molecular formula C21H25N4O3S+ and a molecular weight of 413.52 g/mol. Its IUPAC name is N-cyclopropyl-2-[[2-[4-(thiophene-2-carbonyl)piperazin-1-ium-1-yl]acetyl]amino]benzamide.
| Compound Name | N-cyclopropyl-2-[[2-[4-(thiophene-2-carbonyl)piperazin-1-ium-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 9266837 |
| Molecular Formula | C21H25N4O3S+ |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N-cyclopropyl-2-[[2-[4-(thiophene-2-carbonyl)piperazin-1-ium-1-yl]acetyl]amino]benzamide |
| SMILES | O=C(C[NH+]1CCN(C(=O)c2cccs2)CC1)Nc1ccccc1C(=O)NC1CC1 |
| InChI | InChI=1S/C21H24N4O3S/c26-19(23-17-5-2-1-4-16(17)20(27)22-15-7-8-15)14-24-9-11-25(12-10-24)21(28)18-6-3-13-29-18/h1-6,13,15H,7-12,14H2,(H,22,27)(H,23,26)/p+1 |
| InChIKey | ZRPAOYABBWHZHR-UHFFFAOYSA-O |
| XLogP | 0.62 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |