C20H21N3O4 — CID 25452099
(3R)-3-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-1-phenylpyrrolidin-2-one (PubChem CID 25452099) has the molecular formula C20H21N3O4 and a molecular weight of 367.40 g/mol. Its IUPAC name is (3R)-3-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-1-phenylpyrrolidin-2-one.
| Compound Name | (3R)-3-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-1-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 25452099 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (3R)-3-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-1-phenylpyrrolidin-2-one |
| SMILES | O=C(c1ccco1)N1CCN(C(=O)[C@H]2CCN(c3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C20H21N3O4/c24-18(16-8-9-23(19(16)25)15-5-2-1-3-6-15)21-10-12-22(13-11-21)20(26)17-7-4-14-27-17/h1-7,14,16H,8-13H2/t16-/m1/s1 |
| InChIKey | OFJZPFDPMBMMOK-MRXNPFEDSA-N |
| XLogP | 1.62 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|