C19H24N6O2 — CID 97285430
(3S)-1-phenyl-3-[4-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 97285430) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is (3S)-1-phenyl-3-[4-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | (3S)-1-phenyl-3-[4-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 97285430 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (3S)-1-phenyl-3-[4-[2-(1,2,4-triazol-1-yl)ethyl]piperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | O=C([C@@H]1CCN(c2ccccc2)C1=O)N1CCN(CCn2cncn2)CC1 |
| InChI | InChI=1S/C19H24N6O2/c26-18(17-6-7-25(19(17)27)16-4-2-1-3-5-16)23-11-8-22(9-12-23)10-13-24-15-20-14-21-24/h1-5,14-15,17H,6-13H2/t17-/m0/s1 |
| InChIKey | LIYATKYZRQZDIV-KRWDZBQOSA-N |
| XLogP | 0.48 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|