C14H17N3O4S — CID 124863015
(5R)-3-(furan-2-ylmethyl)-5-(2-oxo-2-thiomorpholin-4-ylethyl)imidazolidine-2,4-dione (PubChem CID 124863015) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is (5R)-3-(furan-2-ylmethyl)-5-(2-oxo-2-thiomorpholin-4-ylethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-3-(furan-2-ylmethyl)-5-(2-oxo-2-thiomorpholin-4-ylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 124863015 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | (5R)-3-(furan-2-ylmethyl)-5-(2-oxo-2-thiomorpholin-4-ylethyl)imidazolidine-2,4-dione |
| SMILES | O=C(C[C@H]1NC(=O)N(Cc2ccco2)C1=O)N1CCSCC1 |
| InChI | InChI=1S/C14H17N3O4S/c18-12(16-3-6-22-7-4-16)8-11-13(19)17(14(20)15-11)9-10-2-1-5-21-10/h1-2,5,11H,3-4,6-9H2,(H,15,20)/t11-/m1/s1 |
| InChIKey | QDRCSOHRWYNHAR-LLVKDONJSA-N |
| XLogP | 0.67 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|