C17H24N4O4 — CID 91639556
N-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(4S)-1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]acetamide (PubChem CID 91639556) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(4S)-1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]acetamide.
| Compound Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(4S)-1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 91639556 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(4S)-1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]acetamide |
| SMILES | CCN1CCCC1CNC(=O)C[C@@H]1NC(=O)N(Cc2ccco2)C1=O |
| InChI | InChI=1S/C17H24N4O4/c1-2-20-7-3-5-12(20)10-18-15(22)9-14-16(23)21(17(24)19-14)11-13-6-4-8-25-13/h4,6,8,12,14H,2-3,5,7,9-11H2,1H3,(H,18,22)(H,19,24)/t12?,14-/m0/s1 |
| InChIKey | KXUWXNISRTYLFX-PYMCNQPYSA-N |
| XLogP | 0.69 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|