C15H17N5O4 — CID 126418599
2-[(4R)-1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-(2-pyrazol-1-ylethyl)acetamide (PubChem CID 126418599) has the molecular formula C15H17N5O4 and a molecular weight of 331.33 g/mol. Its IUPAC name is 2-[(4R)-1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-(2-pyrazol-1-ylethyl)acetamide.
| Compound Name | 2-[(4R)-1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-(2-pyrazol-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 126418599 |
| Molecular Formula | C15H17N5O4 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-[(4R)-1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-(2-pyrazol-1-ylethyl)acetamide |
| SMILES | O=C(C[C@H]1NC(=O)N(Cc2ccco2)C1=O)NCCn1cccn1 |
| InChI | InChI=1S/C15H17N5O4/c21-13(16-5-7-19-6-2-4-17-19)9-12-14(22)20(15(23)18-12)10-11-3-1-8-24-11/h1-4,6,8,12H,5,7,9-10H2,(H,16,21)(H,18,23)/t12-/m1/s1 |
| InChIKey | SXYXMXHQVHDGIQ-GFCCVEGCSA-N |
| XLogP | 0.10 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|