C21H24N4O4 — CID 99870969
(5R)-3-(furan-2-ylmethyl)-5-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]imidazolidine-2,4-dione (PubChem CID 99870969) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is (5R)-3-(furan-2-ylmethyl)-5-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-3-(furan-2-ylmethyl)-5-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 99870969 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (5R)-3-(furan-2-ylmethyl)-5-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]imidazolidine-2,4-dione |
| SMILES | O=C(CC[C@H]1NC(=O)N(Cc2ccco2)C1=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H24N4O4/c26-19(24-12-10-23(11-13-24)16-5-2-1-3-6-16)9-8-18-20(27)25(21(28)22-18)15-17-7-4-14-29-17/h1-7,14,18H,8-13,15H2,(H,22,28)/t18-/m1/s1 |
| InChIKey | HXMRKGAYXBUZMR-GOSISDBHSA-N |
| XLogP | 1.83 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|