C20H23N3O5 — CID 110209925
3-[1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]propanamide (PubChem CID 110209925) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is 3-[1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]propanamide.
| Compound Name | 3-[1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]propanamide |
|---|---|
| PubChem CID | 110209925 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 3-[1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]propanamide |
| SMILES | O=C(CCC1NC(=O)N(Cc2ccco2)C1=O)N[C@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C20H23N3O5/c24-13-15(11-14-5-2-1-3-6-14)21-18(25)9-8-17-19(26)23(20(27)22-17)12-16-7-4-10-28-16/h1-7,10,15,17,24H,8-9,11-13H2,(H,21,25)(H,22,27)/t15-,17?/m0/s1 |
| InChIKey | FMJAQNFRHXADMQ-MYJWUSKBSA-N |
| XLogP | 1.20 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|