C18H25N3O4S — CID 124863370
3-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[(2R)-1-hydroxy-4-methylsulfanylbutan-2-yl]propanamide (PubChem CID 124863370) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is 3-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[(2R)-1-hydroxy-4-methylsulfanylbutan-2-yl]propanamide.
| Compound Name | 3-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[(2R)-1-hydroxy-4-methylsulfanylbutan-2-yl]propanamide |
|---|---|
| PubChem CID | 124863370 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]-N-[(2R)-1-hydroxy-4-methylsulfanylbutan-2-yl]propanamide |
| SMILES | CSCC[C@H](CO)NC(=O)CC[C@H]1NC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C18H25N3O4S/c1-26-10-9-14(12-22)19-16(23)8-7-15-17(24)21(18(25)20-15)11-13-5-3-2-4-6-13/h2-6,14-15,22H,7-12H2,1H3,(H,19,23)(H,20,25)/t14-,15-/m1/s1 |
| InChIKey | RTEAVNAKUIHHCZ-HUUCEWRRSA-N |
| XLogP | 1.12 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|