C22H21N5O4S — CID 75356834
3-[1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)propanamide (PubChem CID 75356834) has the molecular formula C22H21N5O4S and a molecular weight of 451.51 g/mol. Its IUPAC name is 3-[1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 75356834 |
| Molecular Formula | C22H21N5O4S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 3-[1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)propanamide |
| SMILES | COc1ccc(CN2C(=O)NC(CCC(=O)Nc3nc(-c4ccccn4)cs3)C2=O)cc1 |
| InChI | InChI=1S/C22H21N5O4S/c1-31-15-7-5-14(6-8-15)12-27-20(29)17(25-22(27)30)9-10-19(28)26-21-24-18(13-32-21)16-4-2-3-11-23-16/h2-8,11,13,17H,9-10,12H2,1H3,(H,25,30)(H,24,26,28) |
| InChIKey | NIJQHVAJQNGBPT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|