C23H24N6O3 — CID 91821927
3-(1-benzyl-2,5-dioxoimidazolidin-4-yl)-N-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]propanamide (PubChem CID 91821927) has the molecular formula C23H24N6O3 and a molecular weight of 432.48 g/mol. Its IUPAC name is 3-(1-benzyl-2,5-dioxoimidazolidin-4-yl)-N-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]propanamide.
| Compound Name | 3-(1-benzyl-2,5-dioxoimidazolidin-4-yl)-N-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]propanamide |
|---|---|
| PubChem CID | 91821927 |
| Molecular Formula | C23H24N6O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 3-(1-benzyl-2,5-dioxoimidazolidin-4-yl)-N-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]propanamide |
| SMILES | O=C(CCC1NC(=O)N(Cc2ccccc2)C1=O)Nc1n[nH]c(CCc2ccccc2)n1 |
| InChI | InChI=1S/C23H24N6O3/c30-20(26-22-25-19(27-28-22)13-11-16-7-3-1-4-8-16)14-12-18-21(31)29(23(32)24-18)15-17-9-5-2-6-10-17/h1-10,18H,11-15H2,(H,24,32)(H2,25,26,27,28,30) |
| InChIKey | SHMWUKJIHRGVDP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|