C21H20N6O3 — CID 91822742
3-(1-benzyl-2,5-dioxoimidazolidin-4-yl)-N-[3-(1H-1,2,4-triazol-5-yl)phenyl]propanamide (PubChem CID 91822742) has the molecular formula C21H20N6O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is 3-(1-benzyl-2,5-dioxoimidazolidin-4-yl)-N-[3-(1H-1,2,4-triazol-5-yl)phenyl]propanamide.
| Compound Name | 3-(1-benzyl-2,5-dioxoimidazolidin-4-yl)-N-[3-(1H-1,2,4-triazol-5-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 91822742 |
| Molecular Formula | C21H20N6O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 3-(1-benzyl-2,5-dioxoimidazolidin-4-yl)-N-[3-(1H-1,2,4-triazol-5-yl)phenyl]propanamide |
| SMILES | O=C(CCC1NC(=O)N(Cc2ccccc2)C1=O)Nc1cccc(-c2ncn[nH]2)c1 |
| InChI | InChI=1S/C21H20N6O3/c28-18(24-16-8-4-7-15(11-16)19-22-13-23-26-19)10-9-17-20(29)27(21(30)25-17)12-14-5-2-1-3-6-14/h1-8,11,13,17H,9-10,12H2,(H,24,28)(H,25,30)(H,22,23,26) |
| InChIKey | YZLNFSLYOALDEP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|