C23H23ClN4O4 — CID 154808853
3-[(3-chlorophenyl)methyl]-5-[2-oxo-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 154808853) has the molecular formula C23H23ClN4O4 and a molecular weight of 454.91 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methyl]-5-[2-oxo-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[(3-chlorophenyl)methyl]-5-[2-oxo-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154808853 |
| Molecular Formula | C23H23ClN4O4 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 3-[(3-chlorophenyl)methyl]-5-[2-oxo-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | O=C(CC1NC(=O)N(Cc2cccc(Cl)c2)C1=O)N1C[C@H]2C[C@@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C23H23ClN4O4/c24-17-4-1-3-14(8-17)11-28-22(31)18(25-23(28)32)9-21(30)26-10-15-7-16(13-26)19-5-2-6-20(29)27(19)12-15/h1-6,8,15-16,18H,7,9-13H2,(H,25,32)/t15-,16+,18?/m1/s1 |
| InChIKey | LFIBIVLDUYTWNC-LNKXUWQBSA-N |
| XLogP | 1.96 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|