C14H20ClNO3S2 — CID 121191370
3-chloro-1-(1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-2,2-dimethylpropan-1-one (PubChem CID 121191370) has the molecular formula C14H20ClNO3S2 and a molecular weight of 349.91 g/mol. Its IUPAC name is 3-chloro-1-(1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 3-chloro-1-(1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 121191370 |
| Molecular Formula | C14H20ClNO3S2 |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 3-chloro-1-(1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(CCl)C(=O)N1CCC(c2cccs2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C14H20ClNO3S2/c1-14(2,10-15)13(17)16-6-5-12(11-4-3-8-20-11)21(18,19)9-7-16/h3-4,8,12H,5-7,9-10H2,1-2H3 |
| InChIKey | XNIQMALVACNPRC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|