C17H27NO3S2 — CID 121191356
1-(1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-2-propylpentan-1-one (PubChem CID 121191356) has the molecular formula C17H27NO3S2 and a molecular weight of 357.54 g/mol. Its IUPAC name is 1-(1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-2-propylpentan-1-one.
| Compound Name | 1-(1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-2-propylpentan-1-one |
|---|---|
| PubChem CID | 121191356 |
| Molecular Formula | C17H27NO3S2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 1-(1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-2-propylpentan-1-one |
| SMILES | CCCC(CCC)C(=O)N1CCC(c2cccs2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C17H27NO3S2/c1-3-6-14(7-4-2)17(19)18-10-9-16(15-8-5-12-22-15)23(20,21)13-11-18/h5,8,12,14,16H,3-4,6-7,9-11,13H2,1-2H3 |
| InChIKey | FJQLMHGFBQSVIM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |