C19H23NO3S2 — CID 121191448
1-(1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-2-phenylbutan-1-one (PubChem CID 121191448) has the molecular formula C19H23NO3S2 and a molecular weight of 377.53 g/mol. Its IUPAC name is 1-(1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-2-phenylbutan-1-one.
| Compound Name | 1-(1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-2-phenylbutan-1-one |
|---|---|
| PubChem CID | 121191448 |
| Molecular Formula | C19H23NO3S2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 1-(1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl)-2-phenylbutan-1-one |
| SMILES | CCC(C(=O)N1CCC(c2cccs2)S(=O)(=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H23NO3S2/c1-2-16(15-7-4-3-5-8-15)19(21)20-11-10-18(17-9-6-13-24-17)25(22,23)14-12-20/h3-9,13,16,18H,2,10-12,14H2,1H3 |
| InChIKey | KBZSJXLCFHQCSF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |