(2R)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylic acid

C7H9Br2NO2 — CID 18644464

IUPAC(2R)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylic acid
SMILESO=C(O)N1CCC[C@@H]1C=C(Br)Br
InChIInChI=1S/C7H9Br2NO2/c8-6(9)4-5-2-1-3-10(5)7(11)12/h4-5H,1-3H2,(H,11,12)/t5-/m1/s1
InChIKeyNRLAUOGZSHYJFT-RXMQYKEDSA-N
MW298.96 g/mol
LogP2.76
Rot. Bonds1

About (2R)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylic acid

(2R)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylic acid (PubChem CID 18644464) has the molecular formula C7H9Br2NO2 and a molecular weight of 298.96 g/mol. Its IUPAC name is (2R)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylic acid.

Molecular Properties

Compound Name(2R)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylic acid
PubChem CID18644464
Molecular FormulaC7H9Br2NO2
Molecular Weight298.96 g/mol
Exact Mass296.90
IUPAC Name(2R)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylic acid
SMILESO=C(O)N1CCC[C@@H]1C=C(Br)Br
InChIInChI=1S/C7H9Br2NO2/c8-6(9)4-5-2-1-3-10(5)7(11)12/h4-5H,1-3H2,(H,11,12)/t5-/m1/s1
InChIKeyNRLAUOGZSHYJFT-RXMQYKEDSA-N
XLogP2.76
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.96
LogP ≤ 52.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (2R)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylic acid?
The IUPAC name of (2R)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylic acid (CID 18644464) is (2R)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylic acid.
What is the SMILES notation for (2R)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylic acid?
The canonical SMILES for (2R)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylic acid is O=C(O)N1CCC[C@@H]1C=C(Br)Br.
What is the InChIKey of (2R)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylic acid?
The InChIKey is NRLAUOGZSHYJFT-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H9Br2NO2/c8-6(9)4-5-2-1-3-10(5)7(11)12/h4-5H,1-3H2,(H,11,12)/t5-/m1/s1.
What are the key properties of (2R)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylic acid?
(2R)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylic acid has a molecular weight of 298.96 g/mol, XLogP of 2.76, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylic acid is sourced from PubChem (CID 18644464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).