C21H39NO5Si — CID 153284032
tert-butyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]piperidine-1-carboxylate (PubChem CID 153284032) has the molecular formula C21H39NO5Si and a molecular weight of 413.63 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 153284032 |
| Molecular Formula | C21H39NO5Si |
| Molecular Weight | 413.63 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | tert-butyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)/C=C/[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H39NO5Si/c1-10-25-18(23)14-13-16-17(27-28(8,9)21(5,6)7)12-11-15-22(16)19(24)26-20(2,3)4/h13-14,16-17H,10-12,15H2,1-9H3/b14-13+/t16-,17+/m1/s1 |
| InChIKey | NZDDOILTTABIHM-KGWAOHPJSA-N |
| XLogP | 4.90 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|