C20H36N2O5Si — CID 10835514
tert-butyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethenyl]pyrrolidine-1-carboxylate (PubChem CID 10835514) has the molecular formula C20H36N2O5Si and a molecular weight of 412.60 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10835514 |
| Molecular Formula | C20H36N2O5Si |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | tert-butyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1/C=C\[C@H]1COC(=O)N1 |
| InChI | InChI=1S/C20H36N2O5Si/c1-19(2,3)26-18(24)22-12-11-16(27-28(7,8)20(4,5)6)15(22)10-9-14-13-25-17(23)21-14/h9-10,14-16H,11-13H2,1-8H3,(H,21,23)/b10-9-/t14-,15-,16-/m0/s1 |
| InChIKey | AGZKCIKNDBVTFN-QDZDATBCSA-N |
| XLogP | 4.05 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|