C17H34N4O3Si — CID 16732282
tert-butyl (2R,3S)-2-[(1R)-1-azidoethyl]-3-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate (PubChem CID 16732282) has the molecular formula C17H34N4O3Si and a molecular weight of 370.57 g/mol. Its IUPAC name is tert-butyl (2R,3S)-2-[(1R)-1-azidoethyl]-3-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-2-[(1R)-1-azidoethyl]-3-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 16732282 |
| Molecular Formula | C17H34N4O3Si |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | tert-butyl (2R,3S)-2-[(1R)-1-azidoethyl]-3-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
| SMILES | C[C@@H](N=[N+]=[N-])[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H34N4O3Si/c1-12(19-20-18)14-13(24-25(8,9)17(5,6)7)10-11-21(14)15(22)23-16(2,3)4/h12-14H,10-11H2,1-9H3/t12-,13+,14-/m1/s1 |
| InChIKey | CAHIMBWYOZFPFI-HZSPNIEDSA-N |
| XLogP | 5.09 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|