C21H41NO4Si2 — CID 66604974
tert-butyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1-hydroxy-3-trimethylsilylprop-2-ynyl)pyrrolidine-1-carboxylate (PubChem CID 66604974) has the molecular formula C21H41NO4Si2 and a molecular weight of 427.73 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1-hydroxy-3-trimethylsilylprop-2-ynyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1-hydroxy-3-trimethylsilylprop-2-ynyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66604974 |
| Molecular Formula | C21H41NO4Si2 |
| Molecular Weight | 427.73 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | tert-butyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1-hydroxy-3-trimethylsilylprop-2-ynyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C21H41NO4Si2/c1-20(2,3)25-19(24)22-14-12-17(26-28(10,11)21(4,5)6)18(22)16(23)13-15-27(7,8)9/h16-18,23H,12,14H2,1-11H3/t16?,17-,18+/m0/s1 |
| InChIKey | YIMJQQXCGGGGAE-UQJFVLDMSA-N |
| XLogP | 4.63 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.73 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|