C16H29NO3Si — CID 66600482
tert-butyl (2S,4R)-2-(1-hydroxy-3-trimethylsilylprop-2-ynyl)-4-methylpyrrolidine-1-carboxylate (PubChem CID 66600482) has the molecular formula C16H29NO3Si and a molecular weight of 311.50 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-(1-hydroxy-3-trimethylsilylprop-2-ynyl)-4-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-(1-hydroxy-3-trimethylsilylprop-2-ynyl)-4-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66600482 |
| Molecular Formula | C16H29NO3Si |
| Molecular Weight | 311.50 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | tert-butyl (2S,4R)-2-(1-hydroxy-3-trimethylsilylprop-2-ynyl)-4-methylpyrrolidine-1-carboxylate |
| SMILES | C[C@@H]1C[C@@H](C(O)C#C[Si](C)(C)C)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H29NO3Si/c1-12-10-13(14(18)8-9-21(5,6)7)17(11-12)15(19)20-16(2,3)4/h12-14,18H,10-11H2,1-7H3/t12-,13+,14?/m1/s1 |
| InChIKey | BDGHNXKGMXGFIR-AMIUJLCOSA-N |
| XLogP | 2.87 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|