About Tert-butyl 2,5-dimethyl-3-oxopiperidine-1-carboxylate
Tert-butyl 2,5-dimethyl-3-oxopiperidine-1-carboxylate (PubChem CID 155819641) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is tert-butyl 2,5-dimethyl-3-oxopiperidine-1-carboxylate.
Molecular Properties
| Compound Name | Tert-butyl 2,5-dimethyl-3-oxopiperidine-1-carboxylate |
| PubChem CID | 155819641 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | tert-butyl 2,5-dimethyl-3-oxopiperidine-1-carboxylate |
| SMILES | CC1CC(=O)C(N(C1)C(=O)OC(C)(C)C)C |
| InChI | InChI=1S/C12H21NO3/c1-8-6-10(14)9(2)13(7-8)11(15)16-12(3,4)5/h8-9H,6-7H2,1-5H3 |
| InChIKey | MSRCULIGFKZZMR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | 293 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Tert-butyl 2,5-dimethyl-3-oxopiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tert-butyl 2,5-dimethyl-3-oxopiperidine-1-carboxylate?
The IUPAC name of Tert-butyl 2,5-dimethyl-3-oxopiperidine-1-carboxylate (CID 155819641) is tert-butyl 2,5-dimethyl-3-oxopiperidine-1-carboxylate.
What is the SMILES notation for Tert-butyl 2,5-dimethyl-3-oxopiperidine-1-carboxylate?
The canonical SMILES for Tert-butyl 2,5-dimethyl-3-oxopiperidine-1-carboxylate is CC1CC(=O)C(N(C1)C(=O)OC(C)(C)C)C.
What is the InChIKey of Tert-butyl 2,5-dimethyl-3-oxopiperidine-1-carboxylate?
The InChIKey is MSRCULIGFKZZMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3/c1-8-6-10(14)9(2)13(7-8)11(15)16-12(3,4)5/h8-9H,6-7H2,1-5H3.
What are the key properties of Tert-butyl 2,5-dimethyl-3-oxopiperidine-1-carboxylate?
Tert-butyl 2,5-dimethyl-3-oxopiperidine-1-carboxylate has a molecular weight of 227.30 g/mol, XLogP of 1.90, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Tert-butyl 2,5-dimethyl-3-oxopiperidine-1-carboxylate is sourced from PubChem (CID 155819641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).