C17H20ClF3N2O3 — CID 177204927
tert-butyl (2S,5S)-2-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-5-methyl-3-oxopiperidine-1-carboxylate (PubChem CID 177204927) has the molecular formula C17H20ClF3N2O3 and a molecular weight of 392.81 g/mol. Its IUPAC name is tert-butyl (2S,5S)-2-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-5-methyl-3-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5S)-2-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-5-methyl-3-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 177204927 |
| Molecular Formula | C17H20ClF3N2O3 |
| Molecular Weight | 392.81 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | tert-butyl (2S,5S)-2-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-5-methyl-3-oxopiperidine-1-carboxylate |
| SMILES | C[C@H]1CC(=O)[C@H](c2ccc(C(F)(F)F)nc2Cl)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H20ClF3N2O3/c1-9-7-11(24)13(23(8-9)15(25)26-16(2,3)4)10-5-6-12(17(19,20)21)22-14(10)18/h5-6,9,13H,7-8H2,1-4H3/t9-,13-/m0/s1 |
| InChIKey | NRTWIQREZCBCKD-ZANVPECISA-N |
| XLogP | 4.64 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.81 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|